Organometallic Compounds
TARGETMOL CHEMICALS INC Acetoacetic acid sodium salt
Also available in 1 mg, 2 mg, 5 mg, 25 mg, 50 mg, 100 mg, 500 mg and bulk. Please contact Fisher for quotes. Acetoacetic acid sodium salt is a metabolite of non-esterified fatty acids, involved in the development of human diabetes. Purity ≥98%
Apexbio Technology LLC IDE 1 1160927-48-9 5mg
IDE 1 (CAS 1160927-48-9) is a small-molecule compound designed to promote differentiation of stem cells toward the definitive endoderm lineage by activating receptors involved in the TGF- signaling pathway IDE 1 exerts its biological activity primarily through activation of the TGF- signaling pathway In in vitro studies IDE 1 induces definitive endoderm specification from pluripotent stem cells Based on these pharmacological properties IDE 1 holds research potential in in vitro differentiation protocols to generate endoderm-derived cells such as hepatocytes and pancreatic cells and in studies investigating early embryonic lineage commitment and regenerative medicine
Medchemexpress LLC Triisopropylsilane | 6485-79-6 | MFCD00009657 | 1kg
Triisopropylsilane 98% is a strong reducing agent
Medchemexpress LLC Triisopropylsilane | 6485-79-6 | MFCD00009657 | 500g
Triisopropylsilane 98% is a strong reducing agent
Chemscene ChemScene | Triisopropylsilanethiol | 10G | CS-0187703 | 0.98 | 156275-96-6| MFCD00216593 | 190.42
ChemScene | Triisopropylsilanethiol | 10G | CS-0187703 | 0.98 | 156275-96-6| MFCD00216593 | 190.42
C)C(C)C | 100g | 112442353](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000162916.jpg-250.jpg)
eMolecules 6485-79-6 | Triisopropylsilane | Chem-Impex | MFCD00009657 | 158.360 | C9H22Si | 99.000 | CC(C)[SiH](C(C)C)C(C)C | 100g | 112442353
Triisopropylsilane | Chem-Impex | 6485-79-6 | MFCD00009657 | 158.360 | C9H22Si | 99.000 | CC(C)[SiH](C(C)C)C(C)C | 100g | 112442353
C)C(C)C | 5g | 112442351](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000162945.jpg-250.jpg)
eMolecules 6485-79-6 | Triisopropylsilane | Chem-Impex | MFCD00009657 | 158.360 | C9H22Si | 99.000 | CC(C)[SiH](C(C)C)C(C)C | 5g | 112442351
Triisopropylsilane | Chem-Impex | 6485-79-6 | MFCD00009657 | 158.360 | C9H22Si | 99.000 | CC(C)[SiH](C(C)C)C(C)C | 5g | 112442351
C)C(C)C | 10g | 459652140](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000492061.jpg-250.jpg)
eMolecules 6485-79-6 | Triisopropylsilane | Synthonix - Stock | MFCD00009657 | 158.360 | C9H22Si | 96.000 | CC(C)[SiH](C(C)C)C(C)C | 10g | 459652140
Triisopropylsilane | Synthonix - Stock | 6485-79-6 | MFCD00009657 | 158.360 | C9H22Si | 96.000 | CC(C)[SiH](C(C)C)C(C)C | 10g | 459652140
![eMolecules 2144775-48-2 | D-Biotin-PEG6-Thalidomide | Broadpharm791.910 | C37H53N5O12S | 95.000 | O=C(CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@H]12)NCCOCCOCCOCCOCCOCCOCCN1C(=O)CCC(N2C(=O)c3ccccc3C2=O)C1=O | 10mg | 490840929](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502481118.JPG-250.jpg)
eMolecules 2144775-48-2 | D-Biotin-PEG6-Thalidomide | Broadpharm791.910 | C37H53N5O12S | 95.000 | O=C(CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@H]12)NCCOCCOCCOCCOCCOCCOCCN1C(=O)CCC(N2C(=O)c3ccccc3C2=O)C1=O | 10mg | 490840929
D-Biotin-PEG6-Thalidomide | Broadpharm | 2144775-48-2791.910 | C37H53N5O12S | 95.000 | O=C(CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@H]12)NCCOCCOCCOCCOCCOCCOCCN1C(=O)CCC(N2C(=O)c3ccccc3C2=O)C1=O | 10mg | 490840929
eMolecules Palmitamide-PEG2-amide-PEG2-NHS ester | Broadpharm |671.873 | C34H61N3O10 | 98.000 | CCCCCCCCCCCCCCCC(=O)NCCOCCOCCC(=O)NCCOCCOCCC(=O)ON1C(=O)CCC1=O | 100mg | 718091822
Palmitamide-PEG2-amide-PEG2-NHS ester | Broadpharm |671.873 | C34H61N3O10 | 98.000 | CCCCCCCCCCCCCCCC(=O)NCCOCCOCCC(=O)NCCOCCOCCC(=O)ON1C(=O)CCC1=O | 100mg | 718091822
eMolecules 1268955-50-5 | Medchem Express | TXNIP-IN-1 | 5mg | 536983907 | HY-115688 | 248.238 | C12H12N2O4
ChemScene | 1-[(tert-butoxy)carbonyl](methyl)aminocyclopentane-1-carboxylic acid | 100mg | 686164834 | CS-0239678 | 146000-38-6 | MFCD19401009 | 243.303 | C12H21NO4
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules Thalidomide-O-PEG6-NHS ester | Broadpharm |707.686 | C32H41N3O15 | 98.000 | O=C(CCOCCOCCOCCOCCOCCOCCOc1cccc2C(=O)N(C3CCC(=O)NC3=O)C(=O)c12)ON1C(=O)CCC1=O | 100mg | 591908376
Thalidomide-O-PEG6-NHS ester | Broadpharm |707.686 | C32H41N3O15 | 98.000 | O=C(CCOCCOCCOCCOCCOCCOCCOc1cccc2C(=O)N(C3CCC(=O)NC3=O)C(=O)c12)ON1C(=O)CCC1=O | 100mg | 591908376